C15H12Cl2O2 — CID 23073341
4-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde (PubChem CID 23073341) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde.
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 23073341 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde |
| SMILES | Cc1cc(C=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O2/c1-10-6-11(8-18)3-5-15(10)19-9-12-2-4-13(16)14(17)7-12/h2-8H,9H2,1H3 |
| InChIKey | HLNUYMBKCCDYGP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|