C16H12ClN3O2S — CID 973042
[4-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl] acetate (PubChem CID 973042) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is [4-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl] acetate.
| Compound Name | [4-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 973042 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | [4-[2-[(5-chloro-2-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2csc(Nc3ccc(Cl)cn3)n2)cc1 |
| InChI | InChI=1S/C16H12ClN3O2S/c1-10(21)22-13-5-2-11(3-6-13)14-9-23-16(19-14)20-15-7-4-12(17)8-18-15/h2-9H,1H3,(H,18,19,20) |
| InChIKey | JYPOQHBZSGVGCZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|