C21H19ClN2O3S — CID 123388088
[4-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] butanoate (PubChem CID 123388088) has the molecular formula C21H19ClN2O3S and a molecular weight of 414.91 g/mol. Its IUPAC name is [4-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] butanoate.
| Compound Name | [4-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] butanoate |
|---|---|
| PubChem CID | 123388088 |
| Molecular Formula | C21H19ClN2O3S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [4-[2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(CC(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H19ClN2O3S/c1-2-3-20(26)27-17-10-4-14(5-11-17)12-19(25)24-21-23-18(13-28-21)15-6-8-16(22)9-7-15/h4-11,13H,2-3,12H2,1H3,(H,23,24,25) |
| InChIKey | YTAGBYQSSFSPCJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|