C11H5N3S2 — CID 47393622
2-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]propanedinitrile (PubChem CID 47393622) has the molecular formula C11H5N3S2 and a molecular weight of 243.32 g/mol. Its IUPAC name is 2-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 47393622 |
| Molecular Formula | C11H5N3S2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H5N3S2/c12-4-8(5-13)3-10-7-16-11(14-10)9-1-2-15-6-9/h1-3,6-7H |
| InChIKey | QOPDXJVDXJFIGF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|