C19H12N4S — CID 110170086
(E)-2-(1H-benzimidazol-2-yl)-3-(6-thiophen-3-yl-2-pyridinyl)prop-2-enenitrile (PubChem CID 110170086) has the molecular formula C19H12N4S and a molecular weight of 328.40 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(6-thiophen-3-yl-2-pyridinyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(6-thiophen-3-yl-2-pyridinyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110170086 |
| Molecular Formula | C19H12N4S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(6-thiophen-3-yl-2-pyridinyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc(-c2ccsc2)n1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H12N4S/c20-11-14(19-22-17-5-1-2-6-18(17)23-19)10-15-4-3-7-16(21-15)13-8-9-24-12-13/h1-10,12H,(H,22,23)/b14-10+ |
| InChIKey | SWWQPWHFMNZJHQ-GXDHUFHOSA-N |
| XLogP | 4.75 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|