C31H21N5 — CID 3444897
2-(1H-benzimidazol-2-yl)-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile (PubChem CID 3444897) has the molecular formula C31H21N5 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3444897 |
| Molecular Formula | C31H21N5 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C31H21N5/c32-21-25(31-33-27-13-7-8-14-28(27)34-31)19-22-15-17-26(18-16-22)36-30(24-11-5-2-6-12-24)20-29(35-36)23-9-3-1-4-10-23/h1-20H,(H,33,34) |
| InChIKey | CHIOHIPGXPBSDV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|