C14H9N5O2S — CID 135699262
(E)-2-(1H-benzimidazol-2-yl)-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enenitrile (PubChem CID 135699262) has the molecular formula C14H9N5O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135699262 |
| Molecular Formula | C14H9N5O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(O)[nH]c(=S)[nH]c1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H9N5O2S/c15-6-7(5-8-12(20)18-14(22)19-13(8)21)11-16-9-3-1-2-4-10(9)17-11/h1-5H,(H,16,17)(H3,18,19,20,21,22)/b7-5+ |
| InChIKey | LWFFJBXKAQBKNT-FNORWQNLSA-N |
| XLogP | 2.08 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|