C20H18N2O4S3 — CID 60583286
(E)-1-(4-morpholin-4-ylsulfonylphenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 60583286) has the molecular formula C20H18N2O4S3 and a molecular weight of 446.58 g/mol. Its IUPAC name is (E)-1-(4-morpholin-4-ylsulfonylphenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-morpholin-4-ylsulfonylphenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60583286 |
| Molecular Formula | C20H18N2O4S3 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (E)-1-(4-morpholin-4-ylsulfonylphenyl)-3-(2-thiophen-3-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2ccsc2)n1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H18N2O4S3/c23-19(6-3-17-14-28-20(21-17)16-7-12-27-13-16)15-1-4-18(5-2-15)29(24,25)22-8-10-26-11-9-22/h1-7,12-14H,8-11H2/b6-3+ |
| InChIKey | CVCSPPANXYYGLC-ZZXKWVIFSA-N |
| XLogP | 3.79 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|