C15H9N3OS — CID 99891762
(Z)-3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 99891762) has the molecular formula C15H9N3OS and a molecular weight of 279.32 g/mol. Its IUPAC name is (Z)-3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 99891762 |
| Molecular Formula | C15H9N3OS |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (Z)-3-[2-(furan-2-yl)-1,3-thiazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1csc(-c2ccco2)n1)c1ccccn1 |
| InChI | InChI=1S/C15H9N3OS/c16-9-11(13-4-1-2-6-17-13)8-12-10-20-15(18-12)14-5-3-7-19-14/h1-8,10H/b11-8+ |
| InChIKey | ZRBIIAPNBLKFLH-DHZHZOJOSA-N |
| XLogP | 3.86 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|