C15H14N4OS — CID 30589060
N-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-1,3-thiazol-2-yl]-N-ethylacetamide (PubChem CID 30589060) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is N-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-1,3-thiazol-2-yl]-N-ethylacetamide.
| Compound Name | N-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 30589060 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)c1nc(/C=C(\C#N)c2ccccn2)cs1 |
| InChI | InChI=1S/C15H14N4OS/c1-3-19(11(2)20)15-18-13(10-21-15)8-12(9-16)14-6-4-5-7-17-14/h4-8,10H,3H2,1-2H3/b12-8+ |
| InChIKey | YXHGMTOMCJRGQA-XYOKQWHBSA-N |
| XLogP | 2.98 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|