C25H26N4O3S — CID 46671151
2-[[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methylidene]-N,N'-dibenzylpropanediamide (PubChem CID 46671151) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methylidene]-N,N'-dibenzylpropanediamide.
| Compound Name | 2-[[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methylidene]-N,N'-dibenzylpropanediamide |
|---|---|
| PubChem CID | 46671151 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methylidene]-N,N'-dibenzylpropanediamide |
| SMILES | CCN(C(C)=O)c1nc(C=C(C(=O)NCc2ccccc2)C(=O)NCc2ccccc2)cs1 |
| InChI | InChI=1S/C25H26N4O3S/c1-3-29(18(2)30)25-28-21(17-33-25)14-22(23(31)26-15-19-10-6-4-7-11-19)24(32)27-16-20-12-8-5-9-13-20/h4-14,17H,3,15-16H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | LNCJYOYJBAMBKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|