C20H14N6O3 — CID 5337241
5-amino-3-[(Z)-1-cyano-2-(4-methoxy-3-nitrophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 5337241) has the molecular formula C20H14N6O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-amino-3-[(Z)-1-cyano-2-(4-methoxy-3-nitrophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-1-cyano-2-(4-methoxy-3-nitrophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 5337241 |
| Molecular Formula | C20H14N6O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 5-amino-3-[(Z)-1-cyano-2-(4-methoxy-3-nitrophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2nn(-c3ccccc3)c(N)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14N6O3/c1-29-18-8-7-13(10-17(18)26(27)28)9-14(11-21)19-16(12-22)20(23)25(24-19)15-5-3-2-4-6-15/h2-10H,23H2,1H3/b14-9+ |
| InChIKey | QPDQFWJYVDORSD-NTEUORMPSA-N |
| XLogP | 3.31 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|