C30H26N6O4S — CID 2477139
3-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 2477139) has the molecular formula C30H26N6O4S and a molecular weight of 566.64 g/mol. Its IUPAC name is 3-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2477139 |
| Molecular Formula | C30H26N6O4S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 3-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1N=Cc1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C30H26N6O4S/c1-20(2)32-30-35(26(19-41-30)21-8-11-25(12-9-21)36(37)38)31-17-23-18-34(24-6-4-3-5-7-24)33-29(23)22-10-13-27-28(16-22)40-15-14-39-27/h3-13,16-20H,14-15H2,1-2H3/b31-17?,32-30- |
| InChIKey | OXRPMKMCNPFGTH-JVDSUSLYSA-N |
| XLogP | 5.94 |
| TPSA | 109.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|