C23H16FN5O4 — CID 171349842
4-[3-(3-fluorophenyl)-4-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid (PubChem CID 171349842) has the molecular formula C23H16FN5O4 and a molecular weight of 445.41 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-4-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[3-(3-fluorophenyl)-4-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 171349842 |
| Molecular Formula | C23H16FN5O4 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-4-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(/C=N/Nc3ccc([N+](=O)[O-])cc3)c(-c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C23H16FN5O4/c24-18-3-1-2-16(12-18)22-17(13-25-26-19-6-10-21(11-7-19)29(32)33)14-28(27-22)20-8-4-15(5-9-20)23(30)31/h1-14,26H,(H,30,31)/b25-13+ |
| InChIKey | PJKPKOQVCMZANY-DHRITJCHSA-N |
| XLogP | 4.73 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|