C24H20BClN4O4 — CID 172960514
4-[3-(4-boronophenyl)-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid (PubChem CID 172960514) has the molecular formula C24H20BClN4O4 and a molecular weight of 474.71 g/mol. Its IUPAC name is 4-[3-(4-boronophenyl)-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[3-(4-boronophenyl)-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 172960514 |
| Molecular Formula | C24H20BClN4O4 |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 4-[3-(4-boronophenyl)-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
| SMILES | Cc1ccc(N/N=C/c2cn(-c3ccc(C(=O)O)cc3)nc2-c2ccc(B(O)O)cc2)cc1Cl |
| InChI | InChI=1S/C24H20BClN4O4/c1-15-2-9-20(12-22(15)26)28-27-13-18-14-30(21-10-5-17(6-11-21)24(31)32)29-23(18)16-3-7-19(8-4-16)25(33)34/h2-14,28,33-34H,1H3,(H,31,32)/b27-13+ |
| InChIKey | ISQKCHHLOAMENR-UVHMKAGCSA-N |
| XLogP | 3.33 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|