C17H15N5O5 — CID 54432090
ethyl N-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate (PubChem CID 54432090) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is ethyl N-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate.
| Compound Name | ethyl N-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 54432090 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl N-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=Cc1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H15N5O5/c1-2-26-17(23)19-18-10-12-11-21(13-6-4-3-5-7-13)20-16(12)14-8-9-15(27-14)22(24)25/h3-11H,2H2,1H3,(H,19,23) |
| InChIKey | WIEFWGREYKJINA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|