C27H23N5O2 — CID 126395714
N-[(Z)-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide (PubChem CID 126395714) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[(Z)-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide.
| Compound Name | N-[(Z)-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
|---|---|
| PubChem CID | 126395714 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[(Z)-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)CNc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C27H23N5O2/c1-19-14-15-25(34-19)27-21(18-32(31-27)22-10-3-2-4-11-22)16-29-30-26(33)17-28-24-13-7-9-20-8-5-6-12-23(20)24/h2-16,18,28H,17H2,1H3,(H,30,33)/b29-16- |
| InChIKey | HNABABNNAVALNO-MWLSYYOVSA-N |
| XLogP | 5.16 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|