C24H19N3O4 — CID 6302659
3-[5-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 6302659) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-[5-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6302659 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-[5-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(CNc1cccc2ccccc12)N/N=C\c1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C24H19N3O4/c28-23(15-25-21-10-4-6-16-5-1-2-9-20(16)21)27-26-14-19-11-12-22(31-19)17-7-3-8-18(13-17)24(29)30/h1-14,25H,15H2,(H,27,28)(H,29,30)/b26-14- |
| InChIKey | JWXWHLFRWCYYIR-WGARJPEWSA-N |
| XLogP | 4.36 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|