C25H20N4O6 — CID 4541830
[1-(carbamoylamino)-1-oxopropan-2-yl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 4541830) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4541830 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O)C(=O)NC(N)=O |
| InChI | InChI=1S/C25H20N4O6/c1-15(23(31)27-25(26)33)34-21(30)12-11-17-14-29(18-8-3-2-4-9-18)28-22(17)19-13-16-7-5-6-10-20(16)35-24(19)32/h2-15H,1H3,(H3,26,27,31,33) |
| InChIKey | ZEOPIFSXAFSPSB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|