C17H18F3NO3S2 — CID 60560788
(E)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 60560788) has the molecular formula C17H18F3NO3S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 60560788 |
| Molecular Formula | C17H18F3NO3S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | C=CCN(C(=O)/C=C/c1ccc(SC(F)(F)F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18F3NO3S2/c1-2-10-21(14-9-11-26(23,24)12-14)16(22)8-5-13-3-6-15(7-4-13)25-17(18,19)20/h2-8,14H,1,9-12H2/b8-5+ |
| InChIKey | DPBMWHISKAPSOQ-VMPITWQZSA-N |
| XLogP | 3.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|