C19H22F3NO4S2 — CID 42940040
(E)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 42940040) has the molecular formula C19H22F3NO4S2 and a molecular weight of 449.52 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 42940040 |
| Molecular Formula | C19H22F3NO4S2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(SC(F)(F)F)cc1)N(CC1CCCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H22F3NO4S2/c20-19(21,22)28-17-6-3-14(4-7-17)5-8-18(24)23(12-16-2-1-10-27-16)15-9-11-29(25,26)13-15/h3-8,15-16H,1-2,9-13H2/b8-5+ |
| InChIKey | LKOINNLJTUQJLN-VMPITWQZSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|