C22H31NO4S — CID 42944061
(E)-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 42944061) has the molecular formula C22H31NO4S and a molecular weight of 405.56 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 42944061 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)N(CC2CCCO2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H31NO4S/c1-22(2,3)18-9-6-17(7-10-18)8-11-21(24)23(15-20-5-4-13-27-20)19-12-14-28(25,26)16-19/h6-11,19-20H,4-5,12-16H2,1-3H3/b11-8+ |
| InChIKey | BDQDXQOSLMNANK-DHZHZOJOSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|