C24H28BrNO3S — CID 2045077
(E)-N-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 2045077) has the molecular formula C24H28BrNO3S and a molecular weight of 490.46 g/mol. Its IUPAC name is (E)-N-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | (E)-N-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2045077 |
| Molecular Formula | C24H28BrNO3S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (E)-N-[(3-bromophenyl)methyl]-3-(4-tert-butylphenyl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)N(Cc2cccc(Br)c2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H28BrNO3S/c1-24(2,3)20-10-7-18(8-11-20)9-12-23(27)26(22-13-14-30(28,29)17-22)16-19-5-4-6-21(25)15-19/h4-12,15,22H,13-14,16-17H2,1-3H3/b12-9+/t22-/m1/s1 |
| InChIKey | SGXGXZZSKDQGHI-RUCTVCJSSA-N |
| XLogP | 4.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|