C19H22F3NO3S2 — CID 42940164
(E)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 42940164) has the molecular formula C19H22F3NO3S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is (E)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 42940164 |
| Molecular Formula | C19H22F3NO3S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (E)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(SC(F)(F)F)cc1)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H22F3NO3S2/c20-19(21,22)27-17-8-5-14(6-9-17)7-10-18(24)23(15-3-1-2-4-15)16-11-12-28(25,26)13-16/h5-10,15-16H,1-4,11-13H2/b10-7+ |
| InChIKey | ABACGVXCXSEXKD-JXMROGBWSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|