C17H22N2O — CID 115343333
(E)-3-(4-aminophenyl)-N-cyclopentyl-N-prop-2-enylprop-2-enamide (PubChem CID 115343333) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-cyclopentyl-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-cyclopentyl-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 115343333 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-cyclopentyl-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(C(=O)/C=C/c1ccc(N)cc1)C1CCCC1 |
| InChI | InChI=1S/C17H22N2O/c1-2-13-19(16-5-3-4-6-16)17(20)12-9-14-7-10-15(18)11-8-14/h2,7-12,16H,1,3-6,13,18H2/b12-9+ |
| InChIKey | OIGGWOTZEZXGTF-FMIVXFBMSA-N |
| XLogP | 3.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|