C23H26N2O3S — CID 130273644
(E)-N-benzyl-N-(1,1-dioxothiolan-3-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enamide (PubChem CID 130273644) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (E)-N-benzyl-N-(1,1-dioxothiolan-3-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-N-(1,1-dioxothiolan-3-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 130273644 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (E)-N-benzyl-N-(1,1-dioxothiolan-3-yl)-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1CCNC2)N(Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H26N2O3S/c26-23(10-9-19-7-4-8-20-15-24-13-11-22(19)20)25(16-18-5-2-1-3-6-18)21-12-14-29(27,28)17-21/h1-10,21,24H,11-17H2/b10-9+ |
| InChIKey | SFISHBCBVJAEMJ-MDZDMXLPSA-N |
| XLogP | 2.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|