C20H22N2O6S — CID 55984262
N-[3-[2-[(1,1-dioxothiolan-3-yl)-prop-2-enylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55984262) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is N-[3-[2-[(1,1-dioxothiolan-3-yl)-prop-2-enylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[(1,1-dioxothiolan-3-yl)-prop-2-enylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55984262 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[3-[2-[(1,1-dioxothiolan-3-yl)-prop-2-enylamino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | C=CCN(C(=O)COc1cccc(NC(=O)c2ccco2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H22N2O6S/c1-2-9-22(16-8-11-29(25,26)14-16)19(23)13-28-17-6-3-5-15(12-17)21-20(24)18-7-4-10-27-18/h2-7,10,12,16H,1,8-9,11,13-14H2,(H,21,24) |
| InChIKey | TYBBJHGWUPHYCQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|