C19H22N2O6 — CID 119206961
3-[[2-[3-(furan-2-carbonylamino)phenoxy]acetyl]-propan-2-ylamino]propanoic acid (PubChem CID 119206961) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-[[2-[3-(furan-2-carbonylamino)phenoxy]acetyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[2-[3-(furan-2-carbonylamino)phenoxy]acetyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119206961 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[[2-[3-(furan-2-carbonylamino)phenoxy]acetyl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)COc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C19H22N2O6/c1-13(2)21(9-8-18(23)24)17(22)12-27-15-6-3-5-14(11-15)20-19(25)16-7-4-10-26-16/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | XLFIEOQXWIOMHC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |