C20H14N2O4S2 — CID 2336170
[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] 1,3-dioxoisoindole-2-carbodithioate (PubChem CID 2336170) has the molecular formula C20H14N2O4S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is [(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] 1,3-dioxoisoindole-2-carbodithioate.
| Compound Name | [(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] 1,3-dioxoisoindole-2-carbodithioate |
|---|---|
| PubChem CID | 2336170 |
| Molecular Formula | C20H14N2O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | [(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] 1,3-dioxoisoindole-2-carbodithioate |
| SMILES | Cc1ccc(N2C(=O)C[C@H](SC(=S)N3C(=O)c4ccccc4C3=O)C2=O)cc1 |
| InChI | InChI=1S/C20H14N2O4S2/c1-11-6-8-12(9-7-11)21-16(23)10-15(19(21)26)28-20(27)22-17(24)13-4-2-3-5-14(13)18(22)25/h2-9,15H,10H2,1H3/t15-/m0/s1 |
| InChIKey | DLGYXOXXYWPRTP-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|