C18H19F3N2O3S2 — CID 99934674
[(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 99934674) has the molecular formula C18H19F3N2O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is [(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 99934674 |
| Molecular Formula | C18H19F3N2O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] (2S,6R)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@@H]1CN(C(=S)S[C@@H]2CC(=O)N(c3cccc(C(F)(F)F)c3)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C18H19F3N2O3S2/c1-10-8-22(9-11(2)26-10)17(27)28-14-7-15(24)23(16(14)25)13-5-3-4-12(6-13)18(19,20)21/h3-6,10-11,14H,7-9H2,1-2H3/t10-,11+,14-/m1/s1 |
| InChIKey | WMYKYMPLOKCXRV-UHIISALHSA-N |
| XLogP | 3.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|