C19H24N2O4S2 — CID 124668787
[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 124668787) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 124668787 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](SC(=S)N3C[C@@H](C)O[C@H](C)C3)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-4-24-15-7-5-14(6-8-15)21-17(22)9-16(18(21)23)27-19(26)20-10-12(2)25-13(3)11-20/h5-8,12-13,16H,4,9-11H2,1-3H3/t12-,13-,16+/m1/s1 |
| InChIKey | QFAKAMOUTZOQMW-IOASZLSFSA-N |
| XLogP | 2.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|