C14H14N4O3S — CID 711082
(3S)-1-(4-ethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 711082) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is (3S)-1-(4-ethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-ethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 711082 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (3S)-1-(4-ethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](Sc3ncn[nH]3)C2=O)cc1 |
| InChI | InChI=1S/C14H14N4O3S/c1-2-21-10-5-3-9(4-6-10)18-12(19)7-11(13(18)20)22-14-15-8-16-17-14/h3-6,8,11H,2,7H2,1H3,(H,15,16,17)/t11-/m0/s1 |
| InChIKey | SUWSYCDPBOIRII-NSHDSACASA-N |
| XLogP | 1.63 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|