C18H14FN3O2S — CID 2950022
3-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 2950022) has the molecular formula C18H14FN3O2S and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2950022 |
| Molecular Formula | C18H14FN3O2S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(SCc2nc3ccccc3[nH]2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3O2S/c19-11-5-7-12(8-6-11)22-17(23)9-15(18(22)24)25-10-16-20-13-3-1-2-4-14(13)21-16/h1-8,15H,9-10H2,(H,20,21) |
| InChIKey | XJNWGZXILLHYJE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|