C18H13N3O4 — CID 19354480
1-[4-(1H-benzimidazole-2-carbonyl)phenyl]-3-hydroxypyrrolidine-2,5-dione (PubChem CID 19354480) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazole-2-carbonyl)phenyl]-3-hydroxypyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1H-benzimidazole-2-carbonyl)phenyl]-3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19354480 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[4-(1H-benzimidazole-2-carbonyl)phenyl]-3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(N2C(=O)CC(O)C2=O)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H13N3O4/c22-14-9-15(23)21(18(14)25)11-7-5-10(6-8-11)16(24)17-19-12-3-1-2-4-13(12)20-17/h1-8,14,22H,9H2,(H,19,20) |
| InChIKey | FQKLDETZIQJXBY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|