About 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone
1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone (PubChem CID 143998449) has the molecular formula C24H21N3O3
and a molecular weight of 399.45 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone.
Molecular Properties
| Compound Name | 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone |
| PubChem CID | 143998449 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone |
| SMILES | O=C(c1ccc(Oc2ccccn2)cc1)c1nc2ccccc2[nH]1.O=C1CCCC1 |
| InChI | InChI=1S/C19H13N3O2.C5H8O/c23-18(19-21-15-5-1-2-6-16(15)22-19)13-8-10-14(11-9-13)24-17-7-3-4-12-20-17;6-5-3-1-2-4-5/h1-12H,(H,21,22);1-4H2 |
| InChIKey | XEIMPCDGDOCMHP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone?
The IUPAC name of 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone (CID 143998449) is 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone.
What is the SMILES notation for 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone?
The canonical SMILES for 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone is O=C(c1ccc(Oc2ccccn2)cc1)c1nc2ccccc2[nH]1.O=C1CCCC1.
What is the InChIKey of 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone?
The InChIKey is XEIMPCDGDOCMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O2.C5H8O/c23-18(19-21-15-5-1-2-6-16(15)22-19)13-8-10-14(11-9-13)24-17-7-3-4-12-20-17;6-5-3-1-2-4-5/h1-12H,(H,21,22);1-4H2.
What are the key properties of 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone?
1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone has a molecular weight of 399.45 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-2-yl-(4-pyridin-2-yloxyphenyl)methanone;cyclopentanone is sourced from PubChem (CID 143998449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).