C21H17N5O4 — CID 46207821
3-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-N-(2-hydroxyethyl)pyrazine-2-carboxamide (PubChem CID 46207821) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-N-(2-hydroxyethyl)pyrazine-2-carboxamide.
| Compound Name | 3-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-N-(2-hydroxyethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 46207821 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 3-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-N-(2-hydroxyethyl)pyrazine-2-carboxamide |
| SMILES | O=C(c1ccc(Oc2nccnc2C(=O)NCCO)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H17N5O4/c27-12-11-23-20(29)17-21(24-10-9-22-17)30-14-7-5-13(6-8-14)18(28)19-25-15-3-1-2-4-16(15)26-19/h1-10,27H,11-12H2,(H,23,29)(H,25,26) |
| InChIKey | ONOSLZBGAULGHX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |