C25H21N5O2 — CID 89097468
[4-[3-[(2E,4Z)-2-aminohepta-2,4,6-trien-3-yl]pyrazin-2-yl]oxyphenyl]-(1H-benzimidazol-2-yl)methanone (PubChem CID 89097468) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is [4-[3-[(2E,4Z)-2-aminohepta-2,4,6-trien-3-yl]pyrazin-2-yl]oxyphenyl]-(1H-benzimidazol-2-yl)methanone.
| Compound Name | [4-[3-[(2E,4Z)-2-aminohepta-2,4,6-trien-3-yl]pyrazin-2-yl]oxyphenyl]-(1H-benzimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 89097468 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [4-[3-[(2E,4Z)-2-aminohepta-2,4,6-trien-3-yl]pyrazin-2-yl]oxyphenyl]-(1H-benzimidazol-2-yl)methanone |
| SMILES | C=C/C=C\C(=C(\C)N)c1nccnc1Oc1ccc(C(=O)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H21N5O2/c1-3-4-7-19(16(2)26)22-25(28-15-14-27-22)32-18-12-10-17(11-13-18)23(31)24-29-20-8-5-6-9-21(20)30-24/h3-15H,1,26H2,2H3,(H,29,30)/b7-4-,19-16+ |
| InChIKey | JKQMYVURTDHCAL-OGFSNLOFSA-N |
| XLogP | 4.81 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|