C27H29N3O2 — CID 91146087
1H-benzimidazol-2-yl-[4-[(3-octan-3-yl-2-pyridinyl)oxy]phenyl]methanone (PubChem CID 91146087) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[4-[(3-octan-3-yl-2-pyridinyl)oxy]phenyl]methanone.
| Compound Name | 1H-benzimidazol-2-yl-[4-[(3-octan-3-yl-2-pyridinyl)oxy]phenyl]methanone |
|---|---|
| PubChem CID | 91146087 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1H-benzimidazol-2-yl-[4-[(3-octan-3-yl-2-pyridinyl)oxy]phenyl]methanone |
| SMILES | CCCCCC(CC)c1cccnc1Oc1ccc(C(=O)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-3-5-6-10-19(4-2)22-11-9-18-28-27(22)32-21-16-14-20(15-17-21)25(31)26-29-23-12-7-8-13-24(23)30-26/h7-9,11-19H,3-6,10H2,1-2H3,(H,29,30) |
| InChIKey | SVCBRJQVQRVMCH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|