C6H8ClNO3S — CID 3023680
methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate (PubChem CID 3023680) has the molecular formula C6H8ClNO3S and a molecular weight of 209.65 g/mol. Its IUPAC name is methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 3023680 |
| Molecular Formula | C6H8ClNO3S |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSCN1C(=O)Cl |
| InChI | InChI=1S/C6H8ClNO3S/c1-11-5(9)4-2-12-3-8(4)6(7)10/h4H,2-3H2,1H3 |
| InChIKey | CORDKGQLHLMDGC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|