methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate

C6H8ClNO3S — CID 3023680

IUPACmethyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)C1CSCN1C(=O)Cl
InChIInChI=1S/C6H8ClNO3S/c1-11-5(9)4-2-12-3-8(4)6(7)10/h4H,2-3H2,1H3
InChIKeyCORDKGQLHLMDGC-UHFFFAOYSA-N
MW209.65 g/mol
LogP0.89
Rot. Bonds1

About methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate

methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate (PubChem CID 3023680) has the molecular formula C6H8ClNO3S and a molecular weight of 209.65 g/mol. Its IUPAC name is methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate
PubChem CID3023680
Molecular FormulaC6H8ClNO3S
Molecular Weight209.65 g/mol
Exact Mass208.99
IUPAC Namemethyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)C1CSCN1C(=O)Cl
InChIInChI=1S/C6H8ClNO3S/c1-11-5(9)4-2-12-3-8(4)6(7)10/h4H,2-3H2,1H3
InChIKeyCORDKGQLHLMDGC-UHFFFAOYSA-N
XLogP0.89
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.65
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate (CID 3023680) is methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate is COC(=O)C1CSCN1C(=O)Cl.
What is the InChIKey of methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate?
The InChIKey is CORDKGQLHLMDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNO3S/c1-11-5(9)4-2-12-3-8(4)6(7)10/h4H,2-3H2,1H3.
What are the key properties of methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate?
methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate has a molecular weight of 209.65 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-carbonochloridoyl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 3023680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).