C8H15NO2S — CID 67755279
methyl (3R)-4,5-dimethylthiomorpholine-3-carboxylate (PubChem CID 67755279) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is methyl (3R)-4,5-dimethylthiomorpholine-3-carboxylate.
| Compound Name | methyl (3R)-4,5-dimethylthiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 67755279 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | methyl (3R)-4,5-dimethylthiomorpholine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CSCC(C)N1C |
| InChI | InChI=1S/C8H15NO2S/c1-6-4-12-5-7(9(6)2)8(10)11-3/h6-7H,4-5H2,1-3H3/t6?,7-/m0/s1 |
| InChIKey | XBYUZSMMOZFXEE-MLWJPKLSSA-N |
| XLogP | 0.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |