C15H20FNO3S — CID 90593118
2-ethyl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one (PubChem CID 90593118) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-ethyl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one.
| Compound Name | 2-ethyl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90593118 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-ethyl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one |
| SMILES | CCC(CC)C(=O)N1CC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H20FNO3S/c1-3-11(4-2)15(18)17-9-14(10-17)21(19,20)13-7-5-12(16)6-8-13/h5-8,11,14H,3-4,9-10H2,1-2H3 |
| InChIKey | ACDDZZPGCMSRJO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |