C20H22FNO5S — CID 90593103
(3,4-diethoxyphenyl)-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]methanone (PubChem CID 90593103) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]methanone.
| Compound Name | (3,4-diethoxyphenyl)-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]methanone |
|---|---|
| PubChem CID | 90593103 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (3,4-diethoxyphenyl)-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CC(S(=O)(=O)c3ccc(F)cc3)C2)cc1OCC |
| InChI | InChI=1S/C20H22FNO5S/c1-3-26-18-10-5-14(11-19(18)27-4-2)20(23)22-12-17(13-22)28(24,25)16-8-6-15(21)7-9-16/h5-11,17H,3-4,12-13H2,1-2H3 |
| InChIKey | PMXZHHYUSCZCFJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |