C18H20FNO5S2 — CID 90593218
1-(4-ethoxy-3-methylphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine (PubChem CID 90593218) has the molecular formula C18H20FNO5S2 and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methylphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine.
| Compound Name | 1-(4-ethoxy-3-methylphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90593218 |
| Molecular Formula | C18H20FNO5S2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-(4-ethoxy-3-methylphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC(S(=O)(=O)c3ccc(F)cc3)C2)cc1C |
| InChI | InChI=1S/C18H20FNO5S2/c1-3-25-18-9-8-16(10-13(18)2)27(23,24)20-11-17(12-20)26(21,22)15-6-4-14(19)5-7-15/h4-10,17H,3,11-12H2,1-2H3 |
| InChIKey | ZISXPIMTABFUAF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |