C16H15F2NO5S2 — CID 90593207
1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine (PubChem CID 90593207) has the molecular formula C16H15F2NO5S2 and a molecular weight of 403.43 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90593207 |
| Molecular Formula | C16H15F2NO5S2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
| SMILES | COc1ccc(S(=O)(=O)N2CC(S(=O)(=O)c3ccc(F)cc3)C2)cc1F |
| InChI | InChI=1S/C16H15F2NO5S2/c1-24-16-7-6-13(8-15(16)18)26(22,23)19-9-14(10-19)25(20,21)12-4-2-11(17)3-5-12/h2-8,14H,9-10H2,1H3 |
| InChIKey | KJJHOIIGCGDDLT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |