C12H13FN4O3S — CID 121154938
1-[1-(3-fluoro-4-methoxyphenyl)sulfonylazetidin-3-yl]triazole (PubChem CID 121154938) has the molecular formula C12H13FN4O3S and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxyphenyl)sulfonylazetidin-3-yl]triazole.
| Compound Name | 1-[1-(3-fluoro-4-methoxyphenyl)sulfonylazetidin-3-yl]triazole |
|---|---|
| PubChem CID | 121154938 |
| Molecular Formula | C12H13FN4O3S |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxyphenyl)sulfonylazetidin-3-yl]triazole |
| SMILES | COc1ccc(S(=O)(=O)N2CC(n3ccnn3)C2)cc1F |
| InChI | InChI=1S/C12H13FN4O3S/c1-20-12-3-2-10(6-11(12)13)21(18,19)16-7-9(8-16)17-5-4-14-15-17/h2-6,9H,7-8H2,1H3 |
| InChIKey | WNSGFRTUWCKBQD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |