C11H10F2N4O2S — CID 121154928
1-[1-(3,4-difluorophenyl)sulfonylazetidin-3-yl]triazole (PubChem CID 121154928) has the molecular formula C11H10F2N4O2S and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)sulfonylazetidin-3-yl]triazole.
| Compound Name | 1-[1-(3,4-difluorophenyl)sulfonylazetidin-3-yl]triazole |
|---|---|
| PubChem CID | 121154928 |
| Molecular Formula | C11H10F2N4O2S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)sulfonylazetidin-3-yl]triazole |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CC(n2ccnn2)C1 |
| InChI | InChI=1S/C11H10F2N4O2S/c12-10-2-1-9(5-11(10)13)20(18,19)16-6-8(7-16)17-4-3-14-15-17/h1-5,8H,6-7H2 |
| InChIKey | CBVBVSQSGJVETQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |