C13H16N4O3S — CID 99877483
1-[(3R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole (PubChem CID 99877483) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-[(3R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole.
| Compound Name | 1-[(3R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole |
|---|---|
| PubChem CID | 99877483 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[(3R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl]triazole |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H](n3ccnn3)C2)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-20-12-2-4-13(5-3-12)21(18,19)16-8-6-11(10-16)17-9-7-14-15-17/h2-5,7,9,11H,6,8,10H2,1H3/t11-/m1/s1 |
| InChIKey | ORYBFHWUWRZRPN-LLVKDONJSA-N |
| XLogP | 0.92 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |