C19H17F3N4O2S — CID 99987995
1-[(3S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidin-3-yl]triazole (PubChem CID 99987995) has the molecular formula C19H17F3N4O2S and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-[(3S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidin-3-yl]triazole.
| Compound Name | 1-[(3S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidin-3-yl]triazole |
|---|---|
| PubChem CID | 99987995 |
| Molecular Formula | C19H17F3N4O2S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[(3S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidin-3-yl]triazole |
| SMILES | O=S(=O)(c1ccc(-c2cccc(C(F)(F)F)c2)cc1)N1CC[C@H](n2ccnn2)C1 |
| InChI | InChI=1S/C19H17F3N4O2S/c20-19(21,22)16-3-1-2-15(12-16)14-4-6-18(7-5-14)29(27,28)25-10-8-17(13-25)26-11-9-23-24-26/h1-7,9,11-12,17H,8,10,13H2/t17-/m0/s1 |
| InChIKey | BXXZIBQKQVVPKT-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |