C13H9F8NO3S — CID 90593088
2,2,3,3,4,4,4-heptafluoro-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one (PubChem CID 90593088) has the molecular formula C13H9F8NO3S and a molecular weight of 411.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90593088 |
| Molecular Formula | C13H9F8NO3S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]butan-1-one |
| SMILES | O=C(N1CC(S(=O)(=O)c2ccc(F)cc2)C1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F8NO3S/c14-7-1-3-8(4-2-7)26(24,25)9-5-22(6-9)10(23)11(15,16)12(17,18)13(19,20)21/h1-4,9H,5-6H2 |
| InChIKey | SAGHZASJVSAAGG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|