C16H16F7NO4S — CID 90591890
2,2,3,3,4,4,4-heptafluoro-1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]butan-1-one (PubChem CID 90591890) has the molecular formula C16H16F7NO4S and a molecular weight of 451.36 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90591890 |
| Molecular Formula | C16H16F7NO4S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]butan-1-one |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C16H16F7NO4S/c1-28-10-2-4-11(5-3-10)29(26,27)12-6-8-24(9-7-12)13(25)14(17,18)15(19,20)16(21,22)23/h2-5,12H,6-9H2,1H3 |
| InChIKey | MROYXZDMXROWFE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|